CAS 1414958-25-0

1,4-Oxazepine-4(5H)-carboxylic acid, 6-aminotetrahydro-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:

1,4-Oxazepine-4(5H)-carboxylic acid, 6-aminotetrahydro-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its oxazepine ring structure, which is a seven-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a carboxylic acid moiety and an ester functional group, contributing to its potential reactivity and solubility properties. The presence of a 6-amino group enhances its basicity and may influence its biological activity. The hydrochloride salt form indicates that the compound is protonated, which typically improves its solubility in water and biological fluids, making it more suitable for pharmaceutical applications. The dimethylethyl group suggests steric hindrance, which can affect the compound's interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. However, specific biological activities and applications would require empirical investigation and characterization.

Formula: C₁₀H₂₀N₂O₃·ClH

InChI: InChI=1S/C10H20N2O3.ClH/c1-10(2,3)15-9(13)12-4-5-14-7-8(11)6-12;/h8H,4-7,11H2,1-3H3;1H

InChI key: InChIKey=DKKCZPHHNGTSJD-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(N)COCC1.Cl

Synonyms:

• 1,4-Oxazepine-4(5H)-carboxylic acid, 6-aminotetrahydro-, 1,1-dimethylethyl ester, hydrochloride (1:1)

6-Amino-1,4-oxazepane, N4-BOC protected hydrochloride

CAS: 1414958-25-0

6-Amino-1,4-oxazepane, N4-BOC protected hydrochloride

Purity: ≥95%

Molecular weight: 252.74g/mol

Ref: 54-OR41176