CAS 1414958-99-8

Pyridine, 4-chloro-2-cyclopropyl-, hydrochloride (1:1)

Description:

Pyridine, 4-chloro-2-cyclopropyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro substituent at the 4-position and a cyclopropyl group at the 2-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, where the pyridine moiety is often a key component in drug design. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound represents a specific class of nitrogen-containing heterocycles with diverse applications in various fields of chemistry.

Formula: C₈H₈ClN·ClH

InChI: InChI=1S/C8H8ClN.ClH/c9-7-3-4-10-8(5-7)6-1-2-6;/h3-6H,1-2H2;1H

InChI key: InChIKey=VGPWHYQGXMDVAW-UHFFFAOYSA-N

SMILES: ClC=1C=C(N=CC1)C2CC2.Cl

Synonyms:

• Pyridine, 4-chloro-2-cyclopropyl-, hydrochloride (1:1)

4-Chloro-2-cyclopropyl-pyridine hydrochloride

CAS: 1414958-99-8

Versatile small molecule scaffold

Formula: C₈H₉Cl₂N

Purity: Min. 95%

Molecular weight: 190.07 g/mol

Ref: 3D-PGC95899