
CAS 1414959-23-1
:7-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-, hydrochloride (1:1)
Description:
7-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance typically appears as a hydrochloride salt, indicating that it is a protonated form of the base compound, enhancing its solubility in water. The tetrahydro configuration suggests that the compound has undergone partial hydrogenation, resulting in a saturated ring system that can influence its reactivity and biological activity. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming salts and esters. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and interactions would depend on further studies, including its behavior in biological systems and potential therapeutic uses. As with many quinoline derivatives, it may also possess antimicrobial or antimalarial properties, although detailed studies would be necessary to confirm such activities.
Formula:C10H11NO2·ClH
InChI:InChI=1S/C10H11NO2.ClH/c12-10(13)8-4-3-7-2-1-5-11-9(7)6-8;/h3-4,6,11H,1-2,5H2,(H,12,13);1H
InChI key:InChIKey=RBEVIQGGEUTOJM-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=CC1)CCCN2.Cl
Synonyms:- 7-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.