CAS 1414960-64-7

3-Benzofuranamine, 5-bromo-2,3-dihydro-, hydrochloride (1:1), (3R)-

Description:

3-Benzofuranamine, 5-bromo-2,3-dihydro-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of a bromine atom at the 5-position contributes to its reactivity and potential biological activity. The compound is a hydrochloride salt, indicating that it is typically encountered in a protonated form, which enhances its solubility in water and may influence its pharmacological properties. The (3R)- designation refers to the specific stereochemistry at the chiral center, which can significantly affect the compound's interaction with biological targets. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could confer specific biological activities. As with many organic compounds, its properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.

Formula: C₈H₈BrNO·ClH

InChI: InChI=1S/C8H8BrNO.ClH/c9-5-1-2-8-6(3-5)7(10)4-11-8;/h1-3,7H,4,10H2;1H/t7-;/m0./s1

InChI key: InChIKey=UKCIFENUZLYBRF-FJXQXJEOSA-N

SMILES: N[C@@H]1C=2C(=CC=C(Br)C2)OC1.Cl

Synonyms:

• 3-Benzofuranamine, 5-bromo-2,3-dihydro-, hydrochloride (1:1), (3R)-

(R)-5-Bromo-2,3-dihydro-benzofuran-3-ylamine hydrochloride ee

CAS: 1414960-64-7

Versatile small molecule scaffold

Formula: C₈H₉BrClNO

Purity: Min. 95%

Molecular weight: 250.52 g/mol

Ref: 3D-PGC96064