CAS 141516-24-7

1-Piperazinepropanamine,4-acetyl-(9CI)

Description:

1-Piperazinepropanamine, 4-acetyl- (9CI), with the CAS number 141516-24-7, is a chemical compound characterized by its piperazine ring structure, which is a six-membered heterocyclic amine containing two nitrogen atoms. This compound features a propanamine chain and an acetyl group, contributing to its potential reactivity and biological activity. It is typically classified as an amine and may exhibit properties such as basicity due to the presence of nitrogen atoms, which can accept protons. The acetyl group can influence the compound's solubility and reactivity, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the synthesis of compounds with therapeutic effects. However, specific information regarding its toxicity, stability, and environmental impact would require further investigation and analysis. As with many chemical substances, safety precautions should be observed when handling it in laboratory settings.

Formula: C₉H₁₉N₃O

InChI: InChI=1/C9H19N3O/c1-9(13)12-7-5-11(6-8-12)4-2-3-10/h2-8,10H2,1H3

SMILES: CC(=O)N1CCN(CCCN)CC1

Synonyms:

• 3-(4-Acetylpiperazinyl)propanamine
• 3-(4-Acetylpiperazin-1-Yl)Propan-1-Amine

1-(4-(3-Aminopropyl)piperazin-1-yl)ethanone

CAS: 141516-24-7

Formula: C₉H₁₉N₃O

Color and Shape: Solid

Molecular weight: 185.2667

Ref: IN-DA001GJB

3-(4-Acetylpiperazin-1-yl)propan-1-amine

CAS: 141516-24-7

3-(4-Acetylpiperazin-1-yl)propan-1-amine

Purity: 95%

Molecular weight: 185.27g/mol

Ref: 54-OR318065