CAS 141527-78-8
:Boc-D-Ser-OBzl
Description:
Boc-D-Ser-OBzl, also known as Boc-D-serine benzyl ester, is a chemical compound characterized by its structure, which includes a tert-butyloxycarbonyl (Boc) protecting group attached to the D-serine amino acid, along with a benzyl ester moiety. This compound is typically used in peptide synthesis and organic chemistry as a protected form of D-serine, allowing for selective reactions without interfering with the amino acid's functional groups. The Boc group serves as a temporary protective group for the amino group, while the benzyl ester protects the carboxylic acid group. Boc-D-Ser-OBzl is generally stable under standard laboratory conditions but may require specific conditions for deprotection to yield the active D-serine. Its solubility is influenced by the presence of the benzyl group, which can enhance its lipophilicity. This compound is valuable in the synthesis of peptides and other bioactive molecules, contributing to research in medicinal chemistry and biochemistry.
Formula:C15H21NO5
InChI:InChI=1/C15H21NO5/c1-15(2,3)21-14(19)16-12(9-17)13(18)20-10-11-7-5-4-6-8-11/h4-8,12,17H,9-10H2,1-3H3,(H,16,19)/t12-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](CO)C(=O)OCc1ccccc1)O
Synonyms:- Boc-D-Serine Alpha-Benzyl Ester
- Boc-D-Serine Benzyl Ester
- N-Alpha-T-Butoxycarbonyl-D-Serine Benzyl Ester
- N-Tert-Butoxycarbonyl-D-Serine Benzyl Ester
- Benzyl N-(Tert-Butoxycarbonyl)-D-Serinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Boc-D-serine benzyl ester, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C15H21NO5Purity:95%Molecular weight:295.34D-Serine, N-[(1,1-dimethylethoxy)carbonyl]-, phenylmethyl ester
CAS:Formula:C15H21NO5Purity:98%Color and Shape:SolidMolecular weight:295.3309




