CAS 14155-23-8
:METHYL 4,6-O-BENZYLIDENE-BETA-D-GLUCOPYRANOSIDE
Description:
Methyl 4,6-O-benzylidene-β-D-glucopyranoside is a glycoside derived from glucose, characterized by the presence of a benzylidene group at the 4 and 6 positions of the glucopyranose ring. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as methanol and ethanol, but less soluble in water due to its hydrophobic benzylidene substituents. It is often used in organic synthesis and as a building block in carbohydrate chemistry, particularly in the development of glycosylated compounds. The presence of the benzylidene group enhances its stability and reactivity, making it a useful intermediate in various chemical reactions. Additionally, this compound may exhibit biological activity, which can be explored in pharmacological studies. As with many glycosides, it is important to handle this substance with care, adhering to safety protocols due to potential reactivity and toxicity.
Formula:C14H18O6
InChI:InChI=1/C14H18O6/c1-17-14-11(16)10(15)12-9(19-14)7-18-13(20-12)8-5-3-2-4-6-8/h2-6,9-16H,7H2,1H3/t9-,10-,11-,12-,13?,14-/m1/s1
SMILES:CO[C@H]1[C@@H]([C@H]([C@H]2[C@@H](COC(c3ccccc3)O2)O1)O)O
Synonyms:- Methyl 4,6-O-Benzylidene-B-D-Glucopyranoside
- Methyl-4,6-Benzylidene-Beta-D-Glucopyranoside
- Methyl-4,6-O-Benzyliden-Beta-D-Glucopyranoside
- 4,6-O-Benzylidene-1-O-Methyl-Beta-D-Glucoside
- methyl 4,6-O-benzylidenehexopyranoside
- methyl 4,6-O-(phenylmethylidene)-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 4,6-O-benzylidene-β-D-glucopyranoside
CAS:Methyl 4,6-O-benzylidene-β-D-glucopyranosidePurity:>98%Molecular weight:282.29g/molMethyl 4,6-O-Benzylidene-β-D-glucopyranoside
CAS:Controlled Product<p>Applications Methyl 4,6-O-Benzylidene-β-D-glucopyranoside is used in the selective α-D-glucosylation of methyl 4,6-O-benzylidene-α- and -β-D-glucopyranosides.<br>References Takeo, K., et al.: Carbohydrate Res., 145, 307 (1986),<br></p>Formula:C14H18O6Color and Shape:NeatMolecular weight:282.28Methyl 4,6-O-benzylidene-β-D-glucopyranoside
CAS:<p>Methyl 4,6-O-benzylidene-b-D-glucopyranoside is a nitro derivative of methyl b-D-glucopyranoside. The anomeric proton and the nitro group are in the same plane and on opposite sides of the molecule. This compound has been shown to be both a receptor binding agent and a gelation agent. It is used to study biological membranes because it binds to phospholipids in the cell membrane, which alters its physical properties. Methyl 4,6-O-benzylidene-b-D-glucopyranoside is also known for its ability to form hydrogen bonds with water molecules. This is due to its cavity that can accommodate one water molecule per monomer unit. The crystal structure of this compound has been determined by x ray crystallography and shows that it forms dimers through hydrogen bonding between two molecules in each dimer. These interactions are</p>Formula:C14H18O6Purity:Min. 95%Color and Shape:PowderMolecular weight:282.29 g/mol



