CymitQuimica logo

CAS 1415562-62-7

:

1-[2-(Hexahydro-1H-azepin-1-yl)ethyl]-1H-1,2,3-triazole-4-methanol

Description:
1-[2-(Hexahydro-1H-azepin-1-yl)ethyl]-1H-1,2,3-triazole-4-methanol is a chemical compound characterized by its unique structural features, which include a triazole ring and a hexahydroazepine moiety. The presence of the triazole ring imparts notable stability and potential for diverse reactivity, making it a candidate for various applications in medicinal chemistry and material science. The hexahydroazepine structure contributes to its cyclic nature, which can influence its biological activity and interaction with biological targets. Additionally, the methanol group enhances its solubility in polar solvents, which is beneficial for formulation in pharmaceutical contexts. This compound may exhibit interesting pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a fascinating area of research within the field of organic and medicinal chemistry.
Formula:C11H20N4O
InChI:InChI=1S/C11H20N4O/c16-10-11-9-15(13-12-11)8-7-14-5-3-1-2-4-6-14/h9,16H,1-8,10H2
InChI key:InChIKey=ARTBCDKYNQFQTR-UHFFFAOYSA-N
SMILES:C(CN1CCCCCC1)N2C=C(CO)N=N2
Synonyms:
  • 1H-1,2,3-Triazole-4-methanol, 1-[2-(hexahydro-1H-azepin-1-yl)ethyl]-
  • 1-[2-(Hexahydro-1H-azepin-1-yl)ethyl]-1H-1,2,3-triazole-4-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.