CymitQuimica logo

CAS 1415596-09-6

:

Benzaldehyde, 2-amino-4,5-dichloro-3-methyl-

Description:
Benzaldehyde, 2-amino-4,5-dichloro-3-methyl- is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a dichloro substitution pattern on the benzene ring, specifically at the 4 and 5 positions, along with an amino group at the 2 position and a methyl group at the 3 position. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds with amino groups exhibit basic properties, while the dichloro and methyl groups can affect the electron density of the aromatic ring, potentially altering its reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a unique combination of functional groups that can lead to diverse applications in organic synthesis and pharmaceuticals.
Formula:C8H7Cl2NO
InChI:InChI=1S/C8H7Cl2NO/c1-4-7(10)6(9)2-5(3-12)8(4)11/h2-3H,11H2,1H3
InChI key:InChIKey=RKWAPJBZRDBXLJ-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N)C(C)=C(Cl)C(Cl)=C1
Synonyms:
  • 2-Amino-4,5-dichloro-3-methylbenzaldehyde
  • Benzaldehyde, 2-amino-4,5-dichloro-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.