CAS 1415719-08-2
:3-[(Cyclopropylmethyl)amino]-1-(4-methoxyphenyl)-2,5-pyrrolidinedione
Description:
3-[(Cyclopropylmethyl)amino]-1-(4-methoxyphenyl)-2,5-pyrrolidinedione, identified by its CAS number 1415719-08-2, is a synthetic organic compound characterized by its unique molecular structure, which includes a pyrrolidine ring with two carbonyl groups (indicating the presence of a diketone) and an amino group attached to a cyclopropylmethyl substituent. The presence of a methoxyphenyl group suggests potential aromatic interactions, which may influence its chemical reactivity and biological activity. This compound may exhibit properties typical of pyrrolidine derivatives, such as potential neuroactive effects, due to its structural similarity to known pharmacophores. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. As a relatively complex molecule, it may be of interest in medicinal chemistry for the development of new therapeutic agents, particularly in the context of neurological or psychiatric disorders. Further studies would be necessary to elucidate its specific biological activities and potential applications.
Formula:C15H18N2O3
InChI:InChI=1S/C15H18N2O3/c1-20-12-6-4-11(5-7-12)17-14(18)8-13(15(17)19)16-9-10-2-3-10/h4-7,10,13,16H,2-3,8-9H2,1H3
InChI key:InChIKey=QATLTGNYAGNVSK-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)CC1NCC2CC2)C3=CC=C(OC)C=C3
Synonyms:- 3-[(Cyclopropylmethyl)amino]-1-(4-methoxyphenyl)-2,5-pyrrolidinedione
- 2,5-Pyrrolidinedione, 3-[(cyclopropylmethyl)amino]-1-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.