CAS 1415719-19-5
:Methyl 2-[(3-aminophenyl)thio]-4-pyridinecarboxylate
Description:
Methyl 2-[(3-aminophenyl)thio]-4-pyridinecarboxylate is an organic compound characterized by its complex structure, which includes a pyridine ring, a carboxylate group, and a thioether linkage to an aminophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The amino group can participate in hydrogen bonding and may influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the methyl ester group can undergo hydrolysis, leading to the corresponding carboxylic acid. The presence of sulfur in the thioether linkage may also impart unique electronic properties, affecting the compound's reactivity and interaction with other molecules. Overall, Methyl 2-[(3-aminophenyl)thio]-4-pyridinecarboxylate is a versatile compound with potential applications in pharmaceuticals and organic synthesis, warranting further investigation into its chemical behavior and biological effects.
Formula:C13H12N2O2S
InChI:InChI=1S/C13H12N2O2S/c1-17-13(16)9-5-6-15-12(7-9)18-11-4-2-3-10(14)8-11/h2-8H,14H2,1H3
InChI key:InChIKey=MYZJTCCLSDMKQG-UHFFFAOYSA-N
SMILES:S(C1=CC(C(OC)=O)=CC=N1)C2=CC(N)=CC=C2
Synonyms:- 4-Pyridinecarboxylic acid, 2-[(3-aminophenyl)thio]-, methyl ester
- Methyl 2-[(3-aminophenyl)thio]-4-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.