CAS 1415719-22-0
:4-[(1-Methylethyl)thio]-1,3,5-triazin-2-amine
Description:
4-[(1-Methylethyl)thio]-1,3,5-triazin-2-amine is an organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features a thioether functional group, indicated by the presence of a sulfur atom bonded to an isopropyl group (1-methylethyl), contributing to its unique chemical properties. The amine group attached to the triazine ring enhances its reactivity, making it potentially useful in various chemical applications, including as a building block in agrochemicals or pharmaceuticals. The presence of both sulfur and nitrogen in its structure may impart specific biological activities or interactions, which could be of interest in medicinal chemistry. Additionally, the compound's stability and solubility characteristics would depend on its molecular interactions and the presence of functional groups. Overall, this compound exemplifies the diverse chemistry of triazines and their derivatives, which are known for their versatility in synthetic applications.
Formula:C6H10N4S
InChI:InChI=1S/C6H10N4S/c1-4(2)11-6-9-3-8-5(7)10-6/h3-4H,1-2H3,(H2,7,8,9,10)
InChI key:InChIKey=NUGCOEGULXXBQT-UHFFFAOYSA-N
SMILES:S(C(C)C)C=1N=C(N)N=CN1
Synonyms:- 4-[(1-Methylethyl)thio]-1,3,5-triazin-2-amine
- 1,3,5-Triazin-2-amine, 4-[(1-methylethyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.