CAS 1415719-44-6

1H-Pyrazol-5-amine, 1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-4-methyl-

Description:

1H-Pyrazol-5-amine, 1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-4-methyl- is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features multiple functional groups, including an amine and alkyl substituents, which contribute to its reactivity and potential biological activity. The presence of the ethyl and methyl groups enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound may exhibit various properties such as moderate to high stability under standard conditions, depending on the specific substituents and their arrangement. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's unique configuration may allow for interactions with various receptors or enzymes, making it a candidate for further research in drug discovery and development. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₇N₅

InChI: InChI=1S/C11H17N5/c1-4-15-6-10(9(3)14-15)7-16-11(12)8(2)5-13-16/h5-6H,4,7,12H2,1-3H3

InChI key: InChIKey=NYEQZVBZYLMXDM-UHFFFAOYSA-N

SMILES: C(C1=CN(CC)N=C1C)N2C(N)=C(C)C=N2

Synonyms:

• 2-[(1-Ethyl-3-methylpyrazol-4-yl)methyl]-4-methylpyrazol-3-amine
• 1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-4-methyl-1H-pyrazol-5-amine
• 1H-Pyrazol-5-amine, 1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-4-methyl-