CAS 1415719-49-1

5-Ethyl-1-methyl-1H-pyrazole-3-carboxylic acid hydrazide

Description:

5-Ethyl-1-methyl-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and a methyl group attached to the pyrazole, contributing to its unique properties. The presence of a carboxylic acid hydrazide functional group indicates that it can participate in various chemical reactions, including hydrazone formation and potential applications in medicinal chemistry. The compound's hydrazide functionality may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential solubility in polar solvents, and it may exhibit moderate stability under standard conditions. As with many pyrazole derivatives, it could possess interesting pharmacological properties, warranting further investigation into its applications in drug development or agrochemicals. However, specific data regarding its reactivity, toxicity, and detailed applications would require empirical studies and literature review for comprehensive understanding.

Formula: C₇H₁₂N₄O

InChI: InChI=1S/C7H12N4O/c1-3-5-4-6(7(12)9-8)10-11(5)2/h4H,3,8H2,1-2H3,(H,9,12)

InChI key: InChIKey=RIFQSZRERIEYTR-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1C=C(CC)N(C)N1

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 5-ethyl-1-methyl-, hydrazide
• 5-Ethyl-1-methyl-1H-pyrazole-3-carboxylic acid hydrazide