CAS 1415719-62-8
:1-[4-[(3-Nitro-2-pyridinyl)oxy]phenyl]ethanone
Description:
1-[4-[(3-Nitro-2-pyridinyl)oxy]phenyl]ethanone, identified by its CAS number 1415719-62-8, is an organic compound characterized by its complex structure, which includes a ketone functional group and a nitro-substituted pyridine moiety. This compound features a phenyl ring connected to an ethanone group, with a 3-nitro-2-pyridinyl ether substituent, contributing to its potential biological activity. The presence of the nitro group may impart specific electronic properties, influencing its reactivity and interactions with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may exhibit polar characteristics due to the presence of the nitro and ether functionalities, which can affect its solubility and interaction with various solvents. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied, including pH, temperature, and the presence of other chemical species.
Formula:C13H10N2O4
InChI:InChI=1S/C13H10N2O4/c1-9(16)10-4-6-11(7-5-10)19-13-12(15(17)18)3-2-8-14-13/h2-8H,1H3
InChI key:InChIKey=GUTWCIMUKXSNMF-UHFFFAOYSA-N
SMILES:O(C1=C(N(=O)=O)C=CC=N1)C2=CC=C(C(C)=O)C=C2
Synonyms:- 1-[4-[(3-Nitro-2-pyridinyl)oxy]phenyl]ethanone
- Ethanone, 1-[4-[(3-nitro-2-pyridinyl)oxy]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.