CymitQuimica logo

CAS 141580-71-4

:

2-(PYRID-2-YLOXY)BENZALDEHYDE

Description:
2-(Pyrid-2-yloxy)benzaldehyde, with the CAS number 141580-71-4, is an organic compound characterized by the presence of both a pyridine and an aldehyde functional group. This compound features a benzaldehyde moiety, where a pyridine ring is substituted at the ortho position with an ether linkage. The molecular structure contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. It typically exhibits moderate solubility in organic solvents and may have specific reactivity due to the electron-withdrawing nature of the aldehyde group and the electron-donating properties of the pyridine ring. The compound may also display interesting optical properties, making it a candidate for studies in materials science. Additionally, its synthesis often involves standard organic reactions, such as nucleophilic substitution or condensation reactions. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C12H9NO2
InChI:InChI=1/C12H9NO2/c14-9-10-5-1-2-6-11(10)15-12-7-3-4-8-13-12/h1-9H
InChI key:QCKZHTQRJYCZTD-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C=O)Oc1ccccn1
Synonyms:
  • 2-(Pyridin-2-Yloxy)Benzaldehyde
Found 4 products.