CAS 1415800-44-0

3-[2-[2-[(2-Bromoacetyl)amino]ethoxy]ethoxy]propanoic acid

Description:

3-[2-[2-[(2-Bromoacetyl)amino]ethoxy]ethoxy]propanoic acid is a chemical compound characterized by its complex structure, which includes multiple functional groups. It features a propanoic acid backbone, indicating it has carboxylic acid functionality, which is typically associated with acidic properties. The presence of the bromoacetyl group suggests potential reactivity, particularly in nucleophilic substitution reactions, due to the electrophilic nature of the bromine atom. The ethoxy groups contribute to the compound's solubility in organic solvents and may influence its biological activity. This compound may exhibit properties such as moderate polarity and potential interactions with biological systems, making it of interest in medicinal chemistry. Its specific applications could range from use in drug development to serving as a biochemical probe. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications in various fields. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of bromine and other reactive functional groups.

Formula: C₉H₁₆BrNO₅

InChI: InChI=1S/C9H16BrNO5/c10-7-8(12)11-2-4-16-6-5-15-3-1-9(13)14/h1-7H2,(H,11,12)(H,13,14)

InChI key: InChIKey=PIANHFIJCGRNCU-UHFFFAOYSA-N

SMILES: C(NCCOCCOCCC(O)=O)(CBr)=O

Synonyms:

• Propanoic acid, 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]-
• 3-[2-[2-[(2-Bromoacetyl)amino]ethoxy]ethoxy]propanoic acid

Bromoacetamido-PEG2-Acid

CAS: 1415800-44-0

Formula: C₉H₁₆BrNO₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 298.1310

Ref: IN-DA00A17Y

Bromoacetamido-PEG2-C2-acid

CAS: 1415800-44-0

Bromoacetamido-PEG2-C2-acid is a polyethylene glycol (PEG)-based linker employed for PROTAC synthesis[1].

Formula: C₉H₁₆BrNO₅

Color and Shape: Solid

Molecular weight: 298.13

Ref: TM-T14817

Bromoacetamido-PEG2-Acid

CAS: 1415800-44-0

Bromoacetamido-PEG2-Acid

Purity: 97%

Molecular weight: 298.13g/mol

Ref: 54-BIPG1309

Bromoacetamido-PEG2-C2-acid

CAS: 1415800-44-0

Purity: 95%

Molecular weight: 298.133

Ref: 10-F987019

Bromoacetamido-PEG2-acid

CAS: 1415800-44-0

Bromoacetamido-PEG2-acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Bromoacetamido-PEG2-acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₉H₁₆BrNO₅

Purity: Min. 95%

Molecular weight: 298.13 g/mol

Ref: 3D-QGC80044