CymitQuimica logo

CAS 1415841-37-0

:

1-Methylethyl 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylate

Description:
1-Methylethyl 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylate, with the CAS number 1415841-37-0, is a synthetic chemical compound that belongs to the class of quinoline derivatives. This compound is characterized by its complex molecular structure, which includes a quinoline core, a piperazine moiety, and various functional groups such as a fluoro substituent and an ester group. The presence of the piperazine ring suggests potential pharmacological activity, as piperazine derivatives are often associated with various biological effects. The compound may exhibit properties such as antimicrobial or antitumor activity, although specific biological activities would depend on further empirical studies. Its solubility, stability, and reactivity can vary based on the surrounding conditions and the presence of other chemical entities. As with many synthetic compounds, safety data, including toxicity and environmental impact, should be assessed before use in any application.
Formula:C19H24FN3O3
InChI:InChI=1S/C19H24FN3O3/c1-4-22-11-14(19(25)26-12(2)3)18(24)13-9-15(20)17(10-16(13)22)23-7-5-21-6-8-23/h9-12,21H,4-8H2,1-3H3
InChI key:InChIKey=DDWZXYINJYFFPH-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(C(=O)C(C(OC(C)C)=O)=C1)=CC(F)=C(C2)N3CCNCC3
Synonyms:
  • 1-Methylethyl 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylate
  • 3-Quinolinecarboxylic acid, 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-, 1-methylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.