CAS 14159-57-0: 2-Pyridinemethanol, a-phenyl-
Description:2-Pyridinemethanol, α-phenyl- is an organic compound characterized by the presence of a pyridine ring and a phenyl group attached to a methanol moiety. This compound features a pyridine nitrogen, which contributes to its basicity and potential for hydrogen bonding. The structure typically exhibits a hydroxyl (-OH) group, which enhances its solubility in polar solvents and allows for various chemical reactivity, including potential participation in nucleophilic substitution reactions. The phenyl group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. This compound may be utilized in various applications, including as a building block in organic synthesis, in pharmaceuticals, or as a ligand in coordination chemistry. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. As with many organic compounds, safety precautions should be observed when handling it, given potential toxicity or reactivity.
Formula:C12H11NO
InChI:InChI=1S/C12H11NO/c14-12(10-6-2-1-3-7-10)11-8-4-5-9-13-11/h1-9,12,14H
InChI key:InChIKey=UYESUYBXKHPUDU-UHFFFAOYSA-N
SMILES:OC(C1=NC=CC=C1)C=2C=CC=CC2
- Synonyms:
- (?à)-2-(a-Hydroxybenzyl)pyridine
- (?à)-2-Pyridylphenylmethanol
- (±)-2-Pyridylphenylmethanol
- 1-Phenyl-1-(pyridin-2-yl)methanol
- 2-(a-Hydroxybenzyl)pyridine
- NSC 241060
- Nsc241060
- Phenyl(2-pyridinyl)methanol
- Phenyl(2-pyridyl)methanol
- Phenyl-2-pyridylcarbinol
- See more synonyms
- a-Phenyl-2-pyridinemethanol
- 2-Pyridinemethanol, α-phenyl-
