CAS 14159-57-0
:2-Pyridinemethanol, a-phenyl-
Description:
2-Pyridinemethanol, α-phenyl- is an organic compound characterized by the presence of a pyridine ring and a phenyl group attached to a methanol moiety. This compound features a pyridine nitrogen, which contributes to its basicity and potential for hydrogen bonding. The structure typically exhibits a hydroxyl (-OH) group, which enhances its solubility in polar solvents and allows for various chemical reactivity, including potential participation in nucleophilic substitution reactions. The phenyl group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. This compound may be utilized in various applications, including as a building block in organic synthesis, in pharmaceuticals, or as a ligand in coordination chemistry. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. As with many organic compounds, safety precautions should be observed when handling it, given potential toxicity or reactivity.
Formula:C12H11NO
InChI:InChI=1S/C12H11NO/c14-12(10-6-2-1-3-7-10)11-8-4-5-9-13-11/h1-9,12,14H
InChI key:InChIKey=UYESUYBXKHPUDU-UHFFFAOYSA-N
SMILES:C(O)(C1=CC=CC=C1)C2=CC=CC=N2
Synonyms:- (?à)-2-(a-Hydroxybenzyl)pyridine
- (?à)-2-Pyridylphenylmethanol
- (±)-2-Pyridylphenylmethanol
- 1-Phenyl-1-(pyridin-2-yl)methanol
- 2-(a-Hydroxybenzyl)pyridine
- NSC 241060
- Nsc241060
- Phenyl(2-pyridinyl)methanol
- Phenyl(2-pyridyl)methanol
- Phenyl-2-pyridylcarbinol
- a-Phenyl-2-pyridinemethanol
- 2-Pyridinemethanol, α-phenyl-
- alpha-Phenyl-2-pyridinemethanol
- (+/-)-2-(alpha-Hydroxybenzyl)pyridine
- Carbinoxamine Impurity 2
- Carbinoxamine Impurity B
- 1-Phenyl-1-(2-pyridinyl)methanol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
(±)-Phenyl(pyridin-2-yl)methanol
CAS:Formula:C12H11NOPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:185.232-Pyridinemethanol, α-phenyl-
CAS:Formula:C12H11NOPurity:98%Color and Shape:SolidMolecular weight:185.2218Ref: IN-DA001GNW
1g53.00€5g86.00€10g129.00€25g204.00€50g324.00€100g672.00€10mg29.00€100mg28.00€250mg28.00€(±)-Phenyl(pyridin-2-yl)methanol
CAS:(±)-Phenyl(pyridin-2-yl)methanolPurity:98%Molecular weight:185.23g/molCarbinoxamine Impurity B
CAS:Formula:C12H11NOColor and Shape:White To Off-White SolidMolecular weight:185.23Phenyl(2-pyridyl)methanol
CAS:Controlled ProductFormula:C12H11NOColor and Shape:NeatMolecular weight:185.221-Phenyl-1-(2-pyridinyl)methanol
CAS:1-Phenyl-1-(2-pyridinyl)methanol is an organic compound that has a reactive, functional group. It is used as a solvent in the laboratory and industry. This chemical reacts with chloride to produce 1-chloro-1-phenylmethanol. It can also be reacted with basic groups such as sodium hydroxide to produce 1-phenyl-1-(2-hydroxy pyridinium) methanol. The reaction of 1-phenyl-1-(2-pyridinyl) methanol with carbon tetrachloride produces trichlorobenzene and carbon dioxide. Impurities in this compound include inorganic acids such as hydrochloric acid and sulfuric acid, which are found at levels below 0.5%. Alcohols found in this compound include ethanolamine, which is an impurity at levels exceeding 2%.Formula:C12H11NOPurity:Min. 95%Color and Shape:White PowderMolecular weight:185.22 g/mol2-PYRIDINEMETHANOL, A-PHENYL-
CAS:Formula:C12H11NOPurity:≥98%Color and Shape:No data available.Molecular weight:185.226








