CymitQuimica logo

CAS 1416013-62-1

:

2-Amino-4-bromo-3-fluorobenzoic acid

Description:
2-Amino-4-bromo-3-fluorobenzoic acid is an aromatic compound characterized by the presence of an amino group, a bromine atom, and a fluorine atom attached to a benzoic acid structure. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The amino group (-NH2) is a basic functional group, which can participate in hydrogen bonding and influence the compound's solubility in water. The bromine and fluorine substituents introduce halogen characteristics, affecting the compound's reactivity and stability. The presence of these halogens can also enhance the compound's lipophilicity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The specific arrangement of these substituents on the benzene ring contributes to the compound's unique chemical behavior, including its reactivity in electrophilic aromatic substitution reactions. Overall, 2-Amino-4-bromo-3-fluorobenzoic acid is a versatile compound with potential applications in synthetic organic chemistry and medicinal chemistry.
Formula:C7H5BrFNO2
InChI:InChI=1S/C7H5BrFNO2/c8-4-2-1-3(7(11)12)6(10)5(4)9/h1-2H,10H2,(H,11,12)
InChI key:SFRJQFICUQFDFU-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1C(=O)O)N)F)Br
Found 4 products.