CAS 14161-09-2
:2-METHANESULFONYL-PYRIMIDINE
Description:
2-Methanesulfonyl-pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a methanesulfonyl group (-SO2CH3) at the 2-position of the pyrimidine ring enhances its reactivity and solubility in polar solvents. This compound is typically a white to off-white solid and is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its sulfonyl group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, 2-methanesulfonyl-pyrimidine may exhibit biological activity, which can be explored for potential therapeutic uses. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C5H6N2O2S
InChI:InChI=1/C5H6N2O2S/c1-10(8,9)5-6-3-2-4-7-5/h2-4H,1H3
SMILES:CS(=O)(=O)c1ncccn1
Synonyms:- 2-(Methylsulfonyl)pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Methylsulfonyl)pyrimidine
CAS:Formula:C5H6N2O2SPurity:98%Color and Shape:SolidMolecular weight:158.17832-(Methylsulphonyl)pyrimidine
CAS:<p>2-(Methylsulphonyl)pyrimidine</p>Formula:C5H6N2O2SPurity:≥95%Color and Shape: yellow solidMolecular weight:158.18g/mol2-Methylsulfonylpyrimidine
CAS:Formula:C5H6N2O2SPurity:98%Color and Shape:SolidMolecular weight:158.182-Methanesulfonyl-pyrimidine
CAS:<p>2-Methanesulfonyl-pyrimidine is a thiourea that is used as a catalyst in organic synthesis. It can be prepared by reacting phosphorus oxychloride with malonate and hydrochloric acid at temperatures of about 0°C to 150°C. The chloride anion is replaced by the sulfonyl chloride, which has high affinity for the 2-position of thiourea. This reaction leads to an intermediate that can be hydrolyzed with hydrochloric acid to produce 2-methanesulfonyl-pyrimidine. 2-Methanesulfonyl-pyrimidine is soluble in water and can be used as a catalyst in wastewater treatment processes, such as cyclic oxidation or oxychlorination reactions.</p>Purity:Min. 95%



