
CAS 1416323-33-5
:3-Oxetanamine, 3-(4-iodophenyl)-, hydrochloride (1:1)
Description:
3-Oxetanamine, 3-(4-iodophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxetane ring structure, which contributes to its unique reactivity and potential applications in medicinal chemistry. The presence of the 4-iodophenyl group enhances its biological activity, making it a subject of interest in drug development. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various formulations. The compound may exhibit properties such as basicity due to the amine functional group, which can participate in hydrogen bonding and influence its interaction with biological targets. Its molecular structure suggests potential applications in areas such as organic synthesis, pharmaceuticals, and materials science. Safety and handling precautions should be observed, as with any chemical, particularly considering the presence of iodine, which can pose health risks. Overall, 3-Oxetanamine, 3-(4-iodophenyl)-, hydrochloride is a compound of interest for further research and development in various chemical and pharmaceutical applications.
Formula:C9H10INO·ClH
InChI:InChI=1S/C9H10INO.ClH/c10-8-3-1-7(2-4-8)9(11)5-12-6-9;/h1-4H,5-6,11H2;1H
InChI key:InChIKey=ZUFKXDZYRQSTIK-UHFFFAOYSA-N
SMILES:NC1(COC1)C2=CC=C(I)C=C2.Cl
Synonyms:- 3-(4-Iodophenyl)oxetan-3-amine hydrochloride
- 3-Oxetanamine, 3-(4-iodophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.