CymitQuimica logo

CAS 1416354-36-3

:

5-Iodo-7H-pyrrolo[2,3-d]pyrimidin-2-amine

Description:
5-Iodo-7H-pyrrolo[2,3-d]pyrimidin-2-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features an iodine atom at the 5-position and an amino group at the 2-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with biological targets such as enzymes or receptors. Its structural features suggest that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the iodine atom may enhance its pharmacological properties, such as bioavailability or binding affinity. Overall, 5-Iodo-7H-pyrrolo[2,3-d]pyrimidin-2-amine represents a valuable scaffold for further research in the field of pharmaceuticals and organic synthesis.
Formula:C6H5IN4
InChI:InChI=1S/C6H5IN4/c7-4-2-9-5-3(4)1-10-6(8)11-5/h1-2H,(H3,8,9,10,11)
InChI key:InChIKey=VAQOHRRKRVCAIA-UHFFFAOYSA-N
SMILES:IC=1C=2C(NC1)=NC(N)=NC2
Synonyms:
  • 5-Iodo-7H-pyrrolo[2,3-d]pyrimidin-2-amine
  • 7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 5-iodo-
Found 4 products.