CAS 141636-65-9
:N-(phenylcarbonyl)-L-alanyl-L-alanyl-D-tryptophyl-L-phenylalanyl-D-prolyl-L-prolyl-L-norleucinamide
Description:
N-(phenylcarbonyl)-L-alanyl-L-alanyl-D-tryptophyl-L-phenylalanyl-D-prolyl-L-prolyl-L-norleucinamide, with CAS number 141636-65-9, is a synthetic peptide that exhibits characteristics typical of peptide compounds. It is composed of multiple amino acids, including both L- and D-forms, which can influence its biological activity and stability. The presence of a phenylcarbonyl group suggests potential interactions with aromatic residues, which may enhance its binding affinity to specific receptors or enzymes. This compound may exhibit properties such as solubility in polar solvents, depending on its amino acid composition and side chain characteristics. Additionally, the stereochemistry of the amino acids can affect its conformation and, consequently, its biological function. Peptides like this one are often studied for their potential therapeutic applications, including roles in signaling pathways or as inhibitors in various biological processes. However, detailed studies would be necessary to fully elucidate its specific properties, biological activities, and potential applications in medicinal chemistry or biochemistry.
Formula:C49H61N9O8
InChI:InChI=1/C49H61N9O8/c1-4-5-21-37(42(50)59)54-47(64)40-23-14-25-57(40)49(66)41-24-15-26-58(41)48(65)39(27-32-16-8-6-9-17-32)56-46(63)38(28-34-29-51-36-22-13-12-20-35(34)36)55-44(61)31(3)52-43(60)30(2)53-45(62)33-18-10-7-11-19-33/h6-13,16-20,22,29-31,37-41,51H,4-5,14-15,21,23-28H2,1-3H3,(H2,50,59)(H,52,60)(H,53,62)(H,54,64)(H,55,61)(H,56,63)/t30-,31-,37-,38+,39-,40-,41+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Norleucinamide, N-benzoyl-L-alanyl-L-alanyl-D-tryptophyl-L-phenylalanyl-D-prolyl-L-prolyl-
CAS:Formula:C49H61N9O8Purity:98%Molecular weight:904.0641GR 94800
CAS:Potent and selective tachykinin NK2 receptor antagonistFormula:C49H61N9O8Purity:98%Color and Shape:SolidMolecular weight:904.082Bz-Ala-Ala-D-Trp-Phe-D-Pro-Pro-Nle-NH2
CAS:Bz-Ala-Ala-D-Trp-Phe-D-Pro-Pro-Nle (BAAPPDNP) is a cytosolic Ca2+ antagonist. It inhibits the release of neurotransmitters and neurally induced contractions in rat ileum. BAAPPDNP has been shown to inhibit colonic inflammation by suppressing the production of proinflammatory cytokines, such as IL-6 and TNFα. This compound also inhibits the production of prostaglandin E2 (PGE2) in an in vitro study. BAAPPDNP is a saponin that binds to phospholipids on the cell membrane and blocks calcium channels, which leads to a decrease in intracellular calcium levels. The maleate salt of BAAPPDNP can be used for the treatment of colitis and enteritis caused by various bacteria, such as Clostridium perfringens, Clostridium difficile, SalmoneFormula:C49H61N9O8Purity:Min. 95%Molecular weight:904.06 g/mol



