CAS 14164-34-2
:4,6-dimethyl-2-phenylpyrimidine
Description:
4,6-Dimethyl-2-phenylpyrimidine is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two methyl groups at the 4 and 6 positions and a phenyl group at the 2 position, contributing to its unique structural and chemical properties. It is typically a crystalline solid, exhibiting moderate solubility in organic solvents. The presence of the methyl and phenyl substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, which can be explored in pharmacological studies. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C12H12N2
InChI:InChI=1/C12H12N2/c1-9-8-10(2)14-12(13-9)11-6-4-3-5-7-11/h3-8H,1-2H3
SMILES:Cc1cc(C)nc(c2ccccc2)n1
Synonyms:- Pyrimidine, 4,6-Dimethyl-2-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
