CAS 1416439-58-1
:8-Amino-3-quinolinecarboxylic acid
Description:
8-Amino-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the quinoline ring, contributing to its potential as a versatile building block in medicinal chemistry. The presence of the amino group allows for various derivatization reactions, enhancing its utility in synthesizing pharmaceuticals. The carboxylic acid group can participate in acid-base reactions and can also serve as a site for conjugation with other molecules. This compound may exhibit biological activity, making it of interest in drug development, particularly in the context of antimicrobial or anticancer agents. Its solubility and stability in different solvents can vary, influencing its application in various chemical reactions. As with many quinoline derivatives, it may also display fluorescence properties, which can be useful in analytical applications. Overall, 8-Amino-3-quinolinecarboxylic acid is a compound of significant interest in both synthetic and medicinal chemistry.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c11-8-3-1-2-6-4-7(10(13)14)5-12-9(6)8/h1-5H,11H2,(H,13,14)
InChI key:InChIKey=GTIULENMBMXJGX-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=C(C(O)=O)C=N2)C=CC1
Synonyms:- 8-Amino-3-quinolinecarboxylic acid
- 3-Quinolinecarboxylic acid, 8-amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Quinolinecarboxylic acid, 8-amino-
CAS:Formula:C10H8N2O2Purity:98%Color and Shape:SolidMolecular weight:188.18278-Aminoquinoline-3-carboxylic acid
CAS:8-Aminoquinoline-3-carboxylic acidPurity:98%Molecular weight:188.18g/mol8-Aminoquinoline-3-carboxylic acid
CAS:8-Aminoquinoline-3-carboxylic acid is a small molecule that inhibits the activity of the enzyme, catechol-O-methyltransferase (COMT), which is responsible for the demethylation of dopamine. 8-Aminoquinoline-3-carboxylic acid has been shown to be potent and selective in inhibiting COMT and thereby preventing the degradation of dopamine. This compound has been used in screening assays to identify other small molecules that can act as COMT inhibitors. The role of COMT in neurodegenerative diseases such as Parkinson's disease and Alzheimer's disease has been investigated using this inhibitor as a model system. 8-Aminoquinoline-3-carboxylic acid also binds to methylated DNA, which may explain its effect on cellular growth factor signaling pathways.Formula:C10H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:188.19 g/mol8-Aminoquinoline-3-carboxylic acid
CAS:Formula:C10H8N2O2Purity:98%Color and Shape:SolidMolecular weight:188.186



