
CAS 1416447-74-9
:8-ethyl-2,5-dimethylquinoline
Description:
8-Ethyl-2,5-dimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features an ethyl group at the 8-position and two methyl groups at the 2 and 5 positions of the quinoline structure, contributing to its unique chemical properties. Quinoline derivatives are known for their diverse biological activities, including antimicrobial and antimalarial properties. The presence of alkyl substituents can influence the compound's solubility, stability, and reactivity. Typically, quinolines exhibit moderate to high lipophilicity, which can affect their interaction with biological membranes. Additionally, the compound may participate in various chemical reactions, such as electrophilic substitutions or oxidation, due to the electron-rich nature of the nitrogen atom in the pyridine ring. Its specific applications and behavior in chemical reactions would depend on the context of use, including potential roles in pharmaceuticals or as intermediates in organic synthesis.
Formula:C13H15N
InChI:InChI=1S/C13H15N/c1-4-11-7-5-9(2)12-8-6-10(3)14-13(11)12/h5-8H,4H2,1-3H3
InChI key:CJDDZWALNFEDGF-UHFFFAOYSA-N
SMILES:CCC1=C2C(=C(C=C1)C)C=CC(=N2)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
