CAS 14166-28-0
:(3aR,7aS)-hexahydro-4,7-methano-2-benzofuran-1,3-dione
Description:
The chemical substance known as (3aR,7aS)-hexahydro-4,7-methano-2-benzofuran-1,3-dione, with the CAS number 14166-28-0, is a bicyclic compound characterized by its unique fused ring structure. This compound features a benzofuran moiety, which contributes to its aromatic properties, and contains two carbonyl groups (diones) that enhance its reactivity and potential for forming hydrogen bonds. The stereochemistry indicated by the (3aR,7aS) designation suggests specific spatial arrangements of the atoms, which can influence the compound's biological activity and interactions with other molecules. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of the methano bridge adds to the complexity of the structure, potentially affecting its physical properties such as solubility and melting point. Overall, this compound's unique structural features may lead to diverse applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h4-7H,1-3H2/t4?,5?,6-,7+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(3ar,7as)-hexahydro-4,7-methano-2-benzofuran-1,3-dione
CAS:Formula:C9H10O3Purity:95%Color and Shape:SolidMolecular weight:166.1739rel-(3aR,4S,7R,7aS)-Hexahydro-4,7-methanoisobenzofuran-1,3-dione
CAS:rel-(3aR,4S,7R,7aS)-Hexahydro-4,7-methanoisobenzofuran-1,3-dionePurity:97%(3aR,4S,7R,7aS)-Hexahydro-4,7-methanoisobenzofuran-1,3-dione
CAS:Formula:C9H10O3Purity:95%Color and Shape:SolidMolecular weight:166.176Norbornane-2exo,3exo-dicarboxylic acid-anhydride
CAS:<p>Norbornane-2exo,3exo-dicarboxylic acid-anhydride is a versatile building block that can be used as a reagent and speciality chemical. It also has the potential to be a useful intermediate for the synthesis of complex compounds and research chemicals. Norbornane-2exo,3exo-dicarboxylic acid-anhydride is a high quality compound with a CAS number of 14166-28-0.</p>Formula:C9H10O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:166.17 g/mol(3aR,4S,7R,7aS)-Hexahydro-4,7-methanoisobenzofuran-1,3-dione
CAS:<p>(3aR,4S,7R,7aS)-Hexahydro-4,7-methanoisobenzofuran-1,3-dione is a useful organic compound for research related to life sciences. The catalog number is T65552 and the CAS number is 14166-28-0.</p>Formula:C9H10O3Color and Shape:SolidMolecular weight:166.176







