CymitQuimica logo

CAS 1416712-46-3

:

3-Chloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-b]pyridine

Description:
3-Chloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-b]pyridine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo[4,3-b]pyridine core fused with a tetrahydro-2H-pyran moiety. The presence of a chlorine atom at the 3-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple heteroatoms that can interact with biological targets. The compound's unique arrangement of atoms may also influence its electronic properties, making it a candidate for further studies in drug design and synthesis. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and nitrogen heterocycles, which may pose health risks or environmental concerns.
Formula:C11H12ClN3O
InChI:InChI=1S/C11H12ClN3O/c12-11-10-8(4-3-6-13-10)15(14-11)9-5-1-2-7-16-9/h3-4,6,9H,1-2,5,7H2
InChI key:InChIKey=YZFLIMXLIDAUPB-UHFFFAOYSA-N
SMILES:ClC1=NN(C=2C1=NC=CC2)C3CCCCO3
Synonyms:
  • 3-Chloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-b]pyridine
  • 1H-Pyrazolo[4,3-b]pyridine, 3-chloro-1-(tetrahydro-2H-pyran-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.