CymitQuimica logo

CAS 1416713-26-2

:

3,7-Dibromo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-c]pyridine

Description:
3,7-Dibromo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-c]pyridine is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-c]pyridine core substituted with bromine atoms and a tetrahydro-2H-pyran moiety. The presence of bromine atoms at the 3 and 7 positions enhances its reactivity and may influence its biological activity. The tetrahydro-2H-pyran group contributes to the compound's overall stability and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of heteroatoms and multiple functional groups can lead to diverse interactions with biological macromolecules. As with many brominated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of toxicity and bioaccumulation. Overall, 3,7-Dibromo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-c]pyridine represents a significant compound for further research and exploration in various chemical and biological contexts.
Formula:C11H11Br2N3O
InChI:InChI=1S/C11H11Br2N3O/c12-10-7-4-5-14-11(13)9(7)16(15-10)8-3-1-2-6-17-8/h4-5,8H,1-3,6H2
InChI key:InChIKey=AVFDODBGKIGNTG-UHFFFAOYSA-N
SMILES:BrC1=C2N(N=C(Br)C2=CC=N1)C3CCCCO3
Synonyms:
  • 3,7-Dibromo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-c]pyridine
  • 1H-Pyrazolo[3,4-c]pyridine, 3,7-dibromo-1-(tetrahydro-2H-pyran-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.