CAS 1416713-72-8
:7-Bromo-3-iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-c]pyridine
Description:
7-Bromo-3-iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-c]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazolo[4,3-c]pyridine core, bromine and iodine substituents, and a tetrahydro-2H-pyran moiety. The presence of halogens (bromine and iodine) suggests potential reactivity, particularly in nucleophilic substitution reactions. The tetrahydro-2H-pyran group contributes to the compound's overall stability and may influence its solubility and biological activity. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a candidate for further research in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, potentially leading to applications in drug development. As with many heterocycles, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of atoms and the presence of functional groups. Overall, 7-Bromo-3-iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-c]pyridine represents a significant area of interest in synthetic and medicinal chemistry.
Formula:C11H11BrIN3O
InChI:InChI=1S/C11H11BrIN3O/c12-8-6-14-5-7-10(8)16(15-11(7)13)9-3-1-2-4-17-9/h5-6,9H,1-4H2
InChI key:InChIKey=NWHBSBPKXKTAOL-UHFFFAOYSA-N
SMILES:BrC1=C2N(N=C(I)C2=CN=C1)C3CCCCO3
Synonyms:- 1H-Pyrazolo[4,3-c]pyridine, 7-bromo-3-iodo-1-(tetrahydro-2H-pyran-2-yl)-
- 7-Bromo-3-iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.