CAS 1416714-01-6

Thieno[3,2-b]pyridine-7-carboxylic acid

Description:

Thieno[3,2-b]pyridine-7-carboxylic acid is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its reactivity and solubility in polar solvents. The presence of the thieno and pyridine moieties imparts potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various substitution patterns, which can influence its pharmacological properties. The compound is typically solid at room temperature and may exhibit moderate stability under standard conditions. Additionally, it can participate in various chemical reactions, such as esterification and amidation, due to the reactive carboxylic acid group. Its specific applications and interactions in biological systems are subjects of ongoing research, particularly in the context of developing new therapeutic agents. Overall, Thieno[3,2-b]pyridine-7-carboxylic acid represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₈H₅NO₂S

InChI: InChI=1S/C8H5NO2S/c10-8(11)5-1-3-9-6-2-4-12-7(5)6/h1-4H,(H,10,11)

InChI key: InChIKey=BXMCOQCSDLNNGC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C=CS2)=NC=C1

Synonyms:

• Thieno[3,2-b]pyridine-7-carboxylic acid

thieno[3,2-b]pyridine-7-carboxylic acid

CAS: 1416714-01-6

Formula: C₈H₅NO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.1958

Ref: IN-DA001GU7

THIENO[3,2-B]PYRIDINE-7-CARBOXYLIC ACID

CAS: 1416714-01-6

Formula: C₈H₅NO₂S

Purity: 95.0%

Molecular weight: 179.19

Ref: 10-F513527

Thieno[3,2-b]pyridine-7-carboxylic acid

CAS: 1416714-01-6

Versatile small molecule scaffold

Formula: C₈H₅NO₂S

Purity: Min. 95%

Molecular weight: 179.2 g/mol

Ref: 3D-RGC71401