CymitQuimica logo

CAS 1416714-21-0

:

1-Methyl-7-isoquinolinemethanamine

Description:
1-Methyl-7-isoquinolinemethanamine, identified by its CAS number 1416714-21-0, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance features a methyl group attached to the nitrogen atom of the isoquinoline ring, which contributes to its unique properties. The presence of the amine functional group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. Typically, isoquinoline derivatives exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The compound may possess potential applications in drug development, particularly in targeting specific biological pathways. Its solubility, stability, and reactivity can vary depending on the surrounding conditions, such as pH and solvent polarity. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles of such substances can vary significantly. Further research is often necessary to fully elucidate its properties and potential applications in various fields.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c1-8-11-6-9(7-12)2-3-10(11)4-5-13-8/h2-6H,7,12H2,1H3
InChI key:InChIKey=CCUSDMUJNJMOBM-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=CC(CN)=C2)C=CN1
Synonyms:
  • 1-Methyl-7-isoquinolinemethanamine
  • 7-Isoquinolinemethanamine, 1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.