CAS 1416900-51-0

Platinum(1+), diamminechloro(phenanthridine)-, (SP-4-3)-, nitrate (1:1)

Description:

Platinum(1+), diamminechloro(phenanthridine)-, (SP-4-3)-, nitrate (1:1) is a coordination compound featuring platinum in a +1 oxidation state, which is relatively uncommon compared to its more prevalent +2 and +4 states. This compound includes diammine (two ammonia ligands), a chloro ligand, and a phenanthridine ligand, which contributes to its unique structural and electronic properties. The nitrate component indicates that the compound is likely soluble in polar solvents, and the presence of the phenanthridine ligand suggests potential applications in biological systems or as a pharmaceutical agent due to its ability to intercalate with DNA. The specific stereochemistry, denoted by (SP-4-3), implies a particular spatial arrangement of the ligands around the platinum center, which can influence the compound's reactivity and interaction with biological targets. Overall, this compound exemplifies the diverse chemistry of platinum complexes, particularly in the context of medicinal chemistry and coordination chemistry.

Formula: C₁₃H₁₅ClN₃Pt·NO₃

InChI: InChI=1S/C13H9N.ClH.NO3.2H3N.Pt/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13;;2-1(3)4;;;/h1-9H;1H;;2*1H3;/q;;-1;;;+2/p-1

InChI key: InChIKey=BASOIKFWDYWSNM-UHFFFAOYSA-M

SMILES: [Pt+2]([Cl-])([NH3])([NH3])[N]1=C2C(=C3C(=C1)C=CC=C3)C=CC=C2.N(=O)(=O)[O-]

Synonyms:

• Platinum(1+), diamminechloro(phenanthridine)-, (SP-4-3)-, nitrate (1:1)
• Phenanthriplatin

Phenanthriplatin

CAS: 1416900-51-0

Phenanthriplatin, also known as cis-[Pt(NH3)2-(phenanthridine)Cl]NO3, is a new drug candidate. It belongs to a family of platinum(II)-based agents which includes cisplatin, oxaliplatin and carboplatin. Phenanthriplatin Acts As a Covalent Poison of Topoiso

Formula: C₁₃H₁₁ClN₄O₃Pt

Color and Shape: Solid

Molecular weight: 501.79

Ref: TM-T28398