CAS 141704-11-2
:ethyl 1,3-thiazol-2-ylacetate
Description:
Ethyl 1,3-thiazol-2-ylacetate is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. Ethyl 1,3-thiazol-2-ylacetate is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents such as ethanol and ether, while its solubility in water is limited due to the hydrophobic nature of the ethyl group. The thiazole moiety imparts biological activity, making this compound of interest in medicinal chemistry and agricultural applications, particularly as a potential fungicide or herbicide. Its synthesis often involves the reaction of thiazole derivatives with acetic acid or its derivatives. As with many organic compounds, safety precautions should be observed when handling ethyl 1,3-thiazol-2-ylacetate, as it may pose health risks if ingested or inhaled.
Formula:C7H9NO2S
InChI:InChI=1/C7H9NO2S/c1-2-10-7(9)5-6-8-3-4-11-6/h3-4H,2,5H2,1H3
SMILES:CCOC(=O)Cc1nccs1
Synonyms:- 2-Thiazoleacetic Acid, Ethyl Ester
- Ethyl 1,3-thiazol-2-ylacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Thiazoleacetic acid, ethyl ester
CAS:Formula:C7H9NO2SPurity:97%Color and Shape:LiquidMolecular weight:171.2169Ethyl 2-(thiazol-2-yl)acetate
CAS:Ethyl 2-(thiazol-2-yl)acetatePurity:97%Molecular weight:171.22g/molEthyl 2-(thiazol-2-yl)acetate
CAS:Formula:C7H9NO2SPurity:97%Color and Shape:LiquidMolecular weight:171.21Ethyl 2-(thiazol-2-yl)acetate
CAS:Ethyl 2-(thiazol-2-yl)acetate is a versatile building block that can be used as a reagent, speciality chemical, or useful scaffold. It is an intermediate in the synthesis of various pharmaceuticals, including Cefoperazone and Clopidogrel. This product is useful for the preparation of a variety of compounds, such as research chemicals and fine chemicals. Ethyl 2-(thiazol-2-yl)acetate has high purity and can be used as a reaction component for the production of other compounds.Formula:C7H9NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:171.22 g/mol



