CAS 14174-83-5
:HEXAHYDRO-PYRROLIZIN-1-ONE
Description:
Hexahydro-pyrrolizin-1-one, with the CAS number 14174-83-5, is a cyclic organic compound characterized by its saturated pyrrolizine structure. This compound features a five-membered ring containing nitrogen, which contributes to its unique chemical properties. Typically, hexahydro-pyrrolizin-1-one is a colorless to pale yellow liquid or solid, depending on the temperature and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the carbonyl group (ketone) in its structure enhances its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions. Additionally, hexahydro-pyrrolizin-1-one may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. However, like many nitrogen-containing heterocycles, it should be handled with care due to potential toxicity and reactivity. Proper safety measures should be observed when working with this compound in laboratory settings.
Formula:C7H11NO
InChI:InChI=1/C7H11NO/c9-7-3-5-8-4-1-2-6(7)8/h6H,1-5H2
SMILES:C1CC2C(=O)CCN2C1
Synonyms:- 1H-pyrrolizin-1-one, hexahydro-
- Hexahydro-1H-pyrrolizin-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Hexahydropyrrolizin-1-one
CAS:<p>Hexahydropyrrolizin-1-one is an aryl halide that has been shown to reduce the severity of colitis and other inflammatory bowel diseases. It has been proposed that this drug uses hydrogen bonding with dimethyl fumarate to form a stable, non-polar, hydrophobic complex. This complex is then taken up by intestinal cells and causes the release of inflammatory mediators. Hexahydropyrrolizin-1-one may also be useful in treating infectious diseases caused by gram-positive bacteria due to its ability to inhibit protein synthesis.</p>Formula:C7H11NOPurity:Min. 95%Molecular weight:125.17 g/mol

