CymitQuimica logo

CAS 1417407-29-4

:

3-Bromo-4-fluoropyridin-2-amine

Description:
3-Bromo-4-fluoropyridin-2-amine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and fluorine atoms, as well as an amino group. The molecular structure features a bromine atom at the 3-position and a fluorine atom at the 4-position of the pyridine ring, with an amino group (-NH2) located at the 2-position. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its unique substitution pattern contributes to its potential reactivity and applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both halogen atoms can influence the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the amino group can participate in hydrogen bonding, enhancing its interactions in biological systems. Overall, 3-Bromo-4-fluoropyridin-2-amine is of interest for its potential utility in synthetic organic chemistry and drug discovery.
Formula:C5H4BrFN2
InChI:InChI=1S/C5H4BrFN2/c6-4-3(7)1-2-9-5(4)8/h1-2H,(H2,8,9)
InChI key:DYQZJWKZFRTCET-UHFFFAOYSA-N
SMILES:C1=CN=C(C(=C1F)Br)N
Synonyms:
  • 3-Bromo-4-fluoropyridin-2-amine
  • 2-Pyridinamine, 3-bromo-4-fluoro-
  • 3-Bromo-4-fluoro-pyridin-2-ylamine
  • 4-bromo-3-fluoropyridin-2-amine
  • 2-Amino-3-Bromo-4-Fluoro Pyridine
Found 4 products.