CAS 141743-49-9

2,6-DIFLUORO-4-IODOANILINE

Description:

2,6-Difluoro-4-iodoaniline is an organic compound characterized by the presence of two fluorine atoms and one iodine atom attached to a benzene ring that is also substituted with an amino group (-NH2). This compound belongs to the class of anilines, which are aromatic amines. The presence of halogen substituents, specifically fluorine and iodine, significantly influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds like 2,6-difluoro-4-iodoaniline exhibit moderate to high polarity due to the electronegative halogens and the amino group, which can engage in hydrogen bonding. This compound may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its potential as a building block in organic synthesis. Additionally, the specific arrangement of substituents can affect its electronic properties, making it of interest in the development of dyes or as a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₆H₄F₂IN

InChI: InChI=1/C6H4F2IN/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,10H2

SMILES: c1c(cc(c(c1F)N)F)I

Synonyms:

• Buttpark 120\07-58
• 2,6-Difluoro-4-Iodine-Phenylamine

2,6-Difluoro-4-iodoaniline

CAS: 141743-49-9

Formula: C₆H₄F₂IN

Purity: >98.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 255.01

Ref: 3B-D5214

Benzenamine, 2,6-difluoro-4-iodo-

CAS: 141743-49-9

Formula: C₆H₄F₂IN

Purity: 97%

Color and Shape: Solid

Molecular weight: 255.0039

Ref: IN-DA001GZ6

2,6-Difluoro-4-iodoaniline

CAS: 141743-49-9

2,6-Difluoro-4-iodoaniline

Formula: C₆H₄F₂IN

Purity: 98%

Color and Shape: very dark brown crystalline solid

Molecular weight: 255.00g/mol

Ref: 54-PC5886

2,6-Difluoro-4-iodo-aniline

CAS: 141743-49-9

Formula: C₆H₄F₂IN

Purity: 97%

Color and Shape: Solid

Molecular weight: 255.006

Ref: 10-F033299