CymitQuimica logo

CAS 1417456-04-2

:

2-Amino-6-fluoro-N-phenylbenzamide

Description:
2-Amino-6-fluoro-N-phenylbenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amino group (-NH2), a fluoro substituent, and a phenyl group attached to a benzamide backbone. The presence of the amino group suggests potential basicity and reactivity, while the fluoro group can influence the compound's electronic properties and lipophilicity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the fluorine atom and the phenyl group. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Overall, 2-Amino-6-fluoro-N-phenylbenzamide represents a unique structure that may have implications in various fields, including pharmaceuticals and materials science.
Formula:C13H11FN2O
InChI:InChI=1S/C13H11FN2O/c14-10-7-4-8-11(15)12(10)13(17)16-9-5-2-1-3-6-9/h1-8H,15H2,(H,16,17)
InChI key:InChIKey=UZOTUSBWWZAVQD-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C2=C(F)C=CC=C2N
Synonyms:
  • 2-Amino-6-fluoro-N-phenylbenzamide
  • Benzamide, 2-amino-6-fluoro-N-phenyl-
  • 2-Fluoro-6-amino-N-phenylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.