CymitQuimica logo

CAS 1417551-42-8

:

1,1-Dimethylethyl N-(1-formyl-2-oxabicyclo[2.2.2]oct-4-yl)carbamate

Description:
1,1-Dimethylethyl N-(1-formyl-2-oxabicyclo[2.2.2]oct-4-yl)carbamate, with the CAS number 1417551-42-8, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a bicyclic structure. This compound typically exhibits moderate polarity due to the presence of both hydrophobic (alkyl) and hydrophilic (carbamate) components. Its bicyclic framework contributes to its potential rigidity and may influence its reactivity and interaction with biological systems. The formyl group suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the presence of the dimethyl group can enhance steric hindrance, affecting the compound's overall reactivity and stability. Such characteristics may render it useful in various applications, including medicinal chemistry and materials science, although specific applications would depend on further research into its biological activity and chemical behavior. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-11(2,3)18-10(16)14-12-4-6-13(8-15,7-5-12)17-9-12/h8H,4-7,9H2,1-3H3,(H,14,16)
InChI key:InChIKey=FYKMPFXSXYJVDT-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C12CCC(C=O)(CC1)OC2
Synonyms:
  • 1,1-Dimethylethyl N-(1-formyl-2-oxabicyclo[2.2.2]oct-4-yl)carbamate
  • Carbamic acid, N-(1-formyl-2-oxabicyclo[2.2.2]oct-4-yl)-, 1,1-dimethylethyl ester
Found 4 products.