CAS 1417566-35-8

2-Piperazinone, 4-ethyl-3-methyl-, hydrochloride (1:1)

Description:

2-Piperazinone, 4-ethyl-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an ethyl group at the 4-position and a methyl group at the 3-position of the piperazinone structure, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperazinone moiety suggests potential biological activity, as piperazine derivatives are known for their roles in medicinal chemistry, often exhibiting properties such as anxiolytic, antidepressant, or antimicrobial effects. The compound's molecular structure influences its reactivity, stability, and interaction with biological systems, making it a subject of interest in drug development and research. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₇H₁₄N₂O·ClH

InChI: InChI=1S/C7H14N2O.ClH/c1-3-9-5-4-8-7(10)6(9)2;/h6H,3-5H2,1-2H3,(H,8,10);1H

InChI key: InChIKey=QTCBPFKNOYLFEY-UHFFFAOYSA-N

SMILES: C(C)N1C(C)C(=O)NCC1.Cl

Synonyms:

• 2-Piperazinone, 4-ethyl-3-methyl-, hydrochloride (1:1)

4-ethyl-3-methyl-2-piperazinone hydrochloride

CAS: 1417566-35-8

Formula: C₇H₁₅ClN₂O

Purity: 95.0%

Molecular weight: 178.66

Ref: 10-F360638