
CAS 1417782-08-1
:2-[4-(4-Chlorophenoxy)-2-(trifluoromethyl)phenyl]-3-methyl-1-(1,2,4-triazol-1-yl)butan-2-ol
Description:
The chemical substance known as "2-[4-(4-Chlorophenoxy)-2-(trifluoromethyl)phenyl]-3-methyl-1-(1,2,4-triazol-1-yl)butan-2-ol," with the CAS number 1417782-08-1, is a synthetic organic compound characterized by its complex molecular structure. It features a butanol backbone substituted with a triazole moiety, which is indicative of its potential biological activity, particularly in agricultural applications as a fungicide or herbicide. The presence of a chlorophenoxy group and a trifluoromethyl group suggests enhanced lipophilicity and potential interactions with biological targets. This compound is likely to exhibit specific solubility characteristics, stability under various conditions, and a defined mechanism of action due to its unique functional groups. Its synthesis and application may be of interest in the fields of agrochemistry and pharmaceuticals, where such compounds are evaluated for efficacy and safety. As with any chemical, proper handling and safety measures should be observed, given the potential toxicity associated with halogenated compounds.
Formula:C20H19ClF3N3O2
InChI:InChI=1S/C20H19ClF3N3O2/c1-13(2)19(28,10-27-12-25-11-26-27)17-8-7-16(9-18(17)20(22,23)24)29-15-5-3-14(21)4-6-15/h3-9,11-13,28H,10H2,1-2H3
InChI key:InChIKey=SIIJJFOXEOHODQ-UHFFFAOYSA-N
SMILES:C(CN1C=NC=N1)(C(C)C)(O)C2=C(C(F)(F)F)C=C(OC3=CC=C(Cl)C=C3)C=C2
Synonyms:- Ipfentrifluconazole
- α-[4-(4-Chlorophenoxy)-2-(trifluoromethyl)phenyl]-α-(1-methylethyl)-1H-1,2,4-triazole-1-ethanol
- 2-[4-(4-Chlorophenoxy)-2-(trifluoromethyl)phenyl]-3-methyl-1-(1,2,4-triazol-1-yl)butan-2-ol
- 2-[4-(4-Chlorophenoxy)-2-(trifluoromethyl)phenyl]-3-methyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol
- 1H-1,2,4-Triazole-1-ethanol, α-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-α-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
