CAS 1417789-76-4

Pyrrolo[3,4-b]pyrrole, octahydro-1-methyl-, hydrochloride (1:2), (3aR,6aR)-

Description:

Pyrrolo[3,4-b]pyrrole, octahydro-1-methyl-, hydrochloride (1:2), (3aR,6aR)- is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrole ring fused to another pyrrole-like system. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its hydrochloride salt form. The presence of the hydrochloride indicates that it is a protonated form, which enhances its solubility and stability in aqueous environments. The stereochemistry, denoted by (3aR,6aR), suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in organic electronics or as a precursor in the synthesis of more complex molecules. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as well as regulatory considerations for its use in research or industrial applications.

Formula: C₇H₁₄N₂·2ClH

InChI: InChI=1S/C7H14N2.2ClH/c1-9-3-2-6-4-8-5-7(6)9;;/h6-8H,2-5H2,1H3;2*1H/t6-,7+;;/m1../s1

InChI key: InChIKey=RUMPYDQZJSJKTJ-VJBFUYBPSA-N

SMILES: CN1[C@@]2([C@@](CNC2)(CC1)[H])[H].Cl

Synonyms:

• Pyrrolo[3,4-b]pyrrole, octahydro-1-methyl-, hydrochloride (1:2), (3aR,6aR)-

(3aR,6aR)-1-methyl-hexahydropyrrolo[3,4-b]pyrrole DiHCl

CAS: 1417789-76-4

Formula: C₇H₁₆Cl₂N₂

Purity: 97%

Molecular weight: 199.1213

Ref: IN-DA001H2E

(3aR,6aR)-1-Methyloctahydropyrrolo[3,4-b]pyrrole dihydrochloride

CAS: 1417789-76-4

Purity: >95%

Molecular weight: 199.1199951

Ref: 10-F612732