CymitQuimica logo

CAS 1417793-34-0

:

Pyridine, 4-[[(4-piperidinylmethyl)thio]methyl]-, hydrochloride (1:1)

Description:
Pyridine, 4-[[(4-piperidinylmethyl)thio]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The compound features a piperidine moiety, indicating the presence of a saturated six-membered ring with one nitrogen atom, which contributes to its basicity and potential for forming hydrogen bonds. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, solubility, and reactivity, can be influenced by the presence of the hydrochloride group. Additionally, the presence of sulfur in the thioether linkage may impart unique chemical reactivity and stability characteristics. Overall, this compound's structure suggests potential applications in drug development and synthesis, particularly in the context of compounds targeting the central nervous system or other biological pathways.
Formula:C12H18N2S·ClH
InChI:InChI=1S/C12H18N2S.ClH/c1-5-13-6-2-11(1)9-15-10-12-3-7-14-8-4-12;/h1-2,5-6,12,14H,3-4,7-10H2;1H
InChI key:InChIKey=XFSAKVKUVKWHPC-UHFFFAOYSA-N
SMILES:C(SCC=1C=CN=CC1)C2CCNCC2.Cl
Synonyms:
  • Pyridine, 4-[[(4-piperidinylmethyl)thio]methyl]-, hydrochloride (1:1)
Found 2 products.