CAS 1417793-53-3
:1,1-Dimethylethyl N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinyl]methyl]carbamate
Description:
1,1-Dimethylethyl N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinyl]methyl]carbamate, identified by CAS number 1417793-53-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a piperidine ring, and a pyridine moiety with a chloro and trifluoromethyl substituent. The compound is typically synthesized for use in various applications, including as a potential agrochemical or pharmaceutical agent. Its properties may include moderate to high solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. The presence of halogen atoms in its structure often contributes to its biological activity and potential efficacy in target applications. Safety and handling precautions are essential due to the potential toxicity associated with carbamate compounds, necessitating proper risk assessment and management in laboratory and industrial settings.
Formula:C17H23ClF3N3O2
InChI:InChI=1S/C17H23ClF3N3O2/c1-16(2,3)26-15(25)23-8-11-5-4-6-24(10-11)14-13(18)7-12(9-22-14)17(19,20)21/h7,9,11H,4-6,8,10H2,1-3H3,(H,23,25)
InChI key:InChIKey=JQXIXVPVEQBDDW-UHFFFAOYSA-N
SMILES:ClC1=C(N=CC(C(F)(F)F)=C1)N2CC(CNC(OC(C)(C)C)=O)CCC2
Synonyms:- 1,1-Dimethylethyl N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinyl]methyl]carbamate
- Carbamic acid, N-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-piperidinyl]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
tert-Butyl ((1-(3-chloro-5-(trifluoromethyl)pyridin-2-yl)piperidin-3-yl)methyl)carbamate
CAS:Formula:C17H23ClF3N3O2Molecular weight:393.8316(3'-Chloro-5'-trifluoromethyl-3,4,5,6-tetrahydro-2H-[1,2']bipyridinyl-3-ylmethyl)-carbamic acid tert-butyl ester
CAS:(3'-Chloro-5'-trifluoromethyl-3,4,5,6-tetrahydro-2H-[1,2']bipyridinyl-3-ylmethyl)-carbamic acid tert-butyl ester
Molecular weight:393.83g/mol

