CAS 1417793-64-6

4-Piperidinamine, 1-(1,3-benzodioxol-5-ylmethyl)-N-methyl-, hydrochloride (1:1)

Description:

4-Piperidinamine, 1-(1,3-benzodioxol-5-ylmethyl)-N-methyl-, hydrochloride (1:1), with CAS number 1417793-64-6, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a benzodioxole moiety indicates that it has a fused aromatic structure, contributing to its potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. The N-methyl substitution on the piperidine nitrogen can affect the compound's lipophilicity and receptor binding affinity. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of neuroscience and medicinal chemistry, due to their ability to interact with various neurotransmitter systems. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₁₄H₂₀N₂O₂·ClH

InChI: InChI=1S/C14H20N2O2.ClH/c1-15-12-4-6-16(7-5-12)9-11-2-3-13-14(8-11)18-10-17-13;/h2-3,8,12,15H,4-7,9-10H2,1H3;1H

InChI key: InChIKey=ITONEDRXLMRGJY-UHFFFAOYSA-N

SMILES: C(C=1C=C2C(=CC1)OCO2)N3CCC(NC)CC3.Cl

Synonyms:

• 4-Piperidinamine, 1-(1,3-benzodioxol-5-ylmethyl)-N-methyl-, hydrochloride (1:1)

1-(Benzo[d][1,3]dioxol-5-ylmethyl)-N-methylpiperidin-4-amine hydrochloride

CAS: 1417793-64-6

Formula: C₁₄H₂₁ClN₂O₂

Molecular weight: 284.7817

Ref: IN-DA001H3R