CymitQuimica logo

CAS 1417794-00-3

:

Pyridine, 2-bromo-6-[(3-piperidinylmethyl)thio]-, hydrochloride (1:1)

Description:
Pyridine, 2-bromo-6-[(3-piperidinylmethyl)thio]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a thioether group linked to a piperidine moiety at the 6-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, owing to the structural features of both the pyridine and piperidine components. Its synthesis and handling require standard laboratory safety protocols due to the presence of halogenated and nitrogen-containing groups, which can influence its toxicity and environmental impact. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and material science.
Formula:C11H15BrN2S·ClH
InChI:InChI=1S/C11H15BrN2S.ClH/c12-10-4-1-5-11(14-10)15-8-9-3-2-6-13-7-9;/h1,4-5,9,13H,2-3,6-8H2;1H
InChI key:InChIKey=FPUQLBDQSBYEHM-UHFFFAOYSA-N
SMILES:S(CC1CCCNC1)C=2N=C(Br)C=CC2.Cl
Synonyms:
  • Pyridine, 2-bromo-6-[(3-piperidinylmethyl)thio]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.