CAS 1417794-21-8

1,1-Dimethylethyl N-[(1,2,3,4-tetrahydro-1-isoquinolinyl)methyl]carbamate

Description:

1,1-Dimethylethyl N-[(1,2,3,4-tetrahydro-1-isoquinolinyl)methyl]carbamate, identified by its CAS number 1417794-21-8, is a chemical compound that belongs to the class of carbamates. This substance features a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk and potentially influences its reactivity and solubility. The presence of the tetrahydro-1-isoquinoline structure indicates that it may exhibit biological activity, as isoquinoline derivatives are often associated with various pharmacological properties. The carbamate functional group suggests that this compound may participate in reactions typical of carbamates, such as hydrolysis or nucleophilic substitution. Its molecular structure implies potential applications in medicinal chemistry, possibly as a lead compound for drug development. However, specific characteristics such as melting point, boiling point, solubility, and toxicity would require empirical data for a comprehensive understanding of its properties and potential uses.

Formula: C₁₅H₂₂N₂O₂

InChI: InChI=1S/C15H22N2O2/c1-15(2,3)19-14(18)17-10-13-12-7-5-4-6-11(12)8-9-16-13/h4-7,13,16H,8-10H2,1-3H3,(H,17,18)

InChI key: InChIKey=QVYKNCRSCRVYBA-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1C=2C(CCN1)=CC=CC2

Synonyms:

• 1,1-Dimethylethyl N-[(1,2,3,4-tetrahydro-1-isoquinolinyl)methyl]carbamate
• Carbamic acid, N-[(1,2,3,4-tetrahydro-1-isoquinolinyl)methyl]-, 1,1-dimethylethyl ester

tert-Butyl N-[(1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]carbamate

CAS: 1417794-21-8

Versatile small molecule scaffold

Formula: C₁₅H₂₂N₂O₂

Purity: Min. 95%

Molecular weight: 262.35 g/mol

Ref: 3D-SGC79421