CAS 141799-76-0

1-butyl-3-{2-[3-(5-ethyl-4-phenyl-1H-imidazol-1-yl)propoxy]-6-methylphenyl}urea

Description:

1-Butyl-3-{2-[3-(5-ethyl-4-phenyl-1H-imidazol-1-yl)propoxy]-6-methylphenyl}urea, with the CAS number 141799-76-0, is a synthetic organic compound characterized by its complex structure, which includes a butyl group, a urea moiety, and an imidazole derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of the imidazole ring, which is often associated with pharmacological activity. The presence of various functional groups suggests that it may engage in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Additionally, the compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of hydrophobic and hydrophilic regions may also affect its behavior in biological systems, making it a candidate for further research in drug formulation and delivery systems.

Formula: C₂₆H₃₄N₄O₂

InChI: InChI=1/C26H34N4O2/c1-4-6-16-27-26(31)29-24-20(3)12-10-15-23(24)32-18-11-17-30-19-28-25(22(30)5-2)21-13-8-7-9-14-21/h7-10,12-15,19H,4-6,11,16-18H2,1-3H3,(H2,27,29,31)

SMILES: CCCCN=C(Nc1c(C)cccc1OCCCn1cnc(c2ccccc2)c1CC)O

E-5324

CAS: 141799-76-0

E-5324 is potent cholesterol acyltransferase (ACAT) inhibitor (IC50s: 44 to 190 nM).

Formula: C₂₆H₃₄N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 434.57

Ref: TM-T15187