CAS 141801-26-5: Endomorphin-2
Description:Endomorphin-2 is a naturally occurring peptide that belongs to the class of endogenous opioids, specifically derived from the proenkephalin precursor. It is composed of a sequence of amino acids, typically characterized by its high affinity for mu-opioid receptors, which play a crucial role in pain modulation, reward, and addictive behaviors. Endomorphin-2 is known for its analgesic properties, often exhibiting a stronger effect than morphine while having a lower potential for addiction. The substance is primarily found in the central nervous system and has been studied for its implications in pain relief and the treatment of various neurological disorders. Its structure includes a specific arrangement of amino acids that contributes to its biological activity and receptor binding capabilities. Additionally, research into endomorphin-2 has highlighted its potential therapeutic applications, although further studies are necessary to fully understand its mechanisms and effects in clinical settings.
Formula:C32H37N5O5
InChI:InChI=1/C32H37N5O5/c33-25(18-23-13-15-24(38)16-14-23)32(42)37-17-7-12-28(37)31(41)36-27(20-22-10-5-2-6-11-22)30(40)35-26(29(34)39)19-21-8-3-1-4-9-21/h1-6,8-11,13-16,25-28,38H,7,12,17-20,33H2,(H2,34,39)(H,35,40)(H,36,41)/t25-,26-,27-,28-/m0/s1
- Synonyms:
- Endomorphin-2 (Human, Bovine)
- Ypff-Nh2
- Tyr-Pro-Phe-Phe-Nh2
- (2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-N-[(1S)-1-[[(1S)-1-carbamoyl-2-phenyl-ethyl]carbamoyl]-2-phenyl-ethyl]pyrrolidine-2-carboxamide
- L-tyrosyl-L-prolyl-L-phenylalanyl-L-phenylalaninamide